BOC-D,L-5,5,5-TRIFLUOROLEUCINE structure
|
Common Name | BOC-D,L-5,5,5-TRIFLUOROLEUCINE | ||
|---|---|---|---|---|
| CAS Number | 409333-67-1 | Molecular Weight | 285.26000 | |
| Density | 1.218g/cm3 | Boiling Point | 349.98ºC at 760 mmHg | |
| Molecular Formula | C11H18F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.462ºC | |
| Name | 5,5,5-trifluoro-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 349.98ºC at 760 mmHg |
| Molecular Formula | C11H18F3NO4 |
| Molecular Weight | 285.26000 |
| Flash Point | 165.462ºC |
| Exact Mass | 285.11900 |
| PSA | 75.63000 |
| LogP | 2.94370 |
| Index of Refraction | 1.428 |
| InChIKey | PLTXZUYAJDKNFI-UHFFFAOYSA-N |
| SMILES | CC(CC(NC(=O)OC(C)(C)C)C(=O)O)C(F)(F)F |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| boc-5,5,5-trifluoro-dl-leucine |
| 2-tert-butoxycarbonylamino-5,5,5-trifluoro-4-methyl-pentanoic acid |
| Boc-D,L-5,5,5-trifluoroleucine |