CMPD-1 structure
|
Common Name | CMPD-1 | ||
|---|---|---|---|---|
| CAS Number | 41179-33-3 | Molecular Weight | 349.40 | |
| Density | 1.229g/cm3 | Boiling Point | 585ºC at 760 mmHg | |
| Molecular Formula | C22H20FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.6ºC | |
Use of CMPD-1CMPD1 is a selective and non-ATP-competitive p38 MAPK-mediated MK2 phosphorylation inhibitor with apparent Ki (Kiapp) of 330 nM[1][2]. |
| Name | 4-[4-(2-fluorophenyl)phenyl]-N-(4-hydroxyphenyl)butanamide |
|---|---|
| Synonym | More Synonyms |
| Description | CMPD1 is a selective and non-ATP-competitive p38 MAPK-mediated MK2 phosphorylation inhibitor with apparent Ki (Kiapp) of 330 nM[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Kiapp: 330 nM (MK2 phosphorylation)[2] |
| In Vitro | CMPD1 does not inhibit p38 MAPK-mediated phosphorylation of other two substrates, MBP and ATF2[1]. |
| References |
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 585ºC at 760 mmHg |
| Molecular Formula | C22H20FNO2 |
| Molecular Weight | 349.40 |
| Flash Point | 307.6ºC |
| Exact Mass | 349.14800 |
| PSA | 49.33000 |
| LogP | 5.23270 |
| Index of Refraction | 1.627 |
| InChIKey | ODYAQBDIXCVKAE-UHFFFAOYSA-N |
| SMILES | O=C(CCCc1ccc(-c2ccccc2F)cc1)Nc1ccc(O)cc1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| CMPD1 |
| MK2a Inhibitor |
| Mitogen-activated protein kinase-activated protein kinase 2a Inhibitor |
| MAPKAPK2a Inhibitor |