Lepadin H structure
|
Common Name | Lepadin H | ||
|---|---|---|---|---|
| CAS Number | 412328-25-7 | Molecular Weight | 419.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H45NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lepadin HLepadin H is a marine alkaloid and ferroptosis inducer. Lepadin H exhibits significant cytotoxicity, promotes p53 expression, increases ROS production and lipid peroxidation, decreases SLC7A11 and GPX4 levels, and upregulates ACSL4 expression. Lepadin H induces ferroptosis through the p53-SLC7A11-GPX4 pathway[1]. |
| Name | Lepadin H |
|---|
| Description | Lepadin H is a marine alkaloid and ferroptosis inducer. Lepadin H exhibits significant cytotoxicity, promotes p53 expression, increases ROS production and lipid peroxidation, decreases SLC7A11 and GPX4 levels, and upregulates ACSL4 expression. Lepadin H induces ferroptosis through the p53-SLC7A11-GPX4 pathway[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H45NO3 |
|---|---|
| Molecular Weight | 419.64 |
| InChIKey | RLTXIRPCJHXWEP-AFEGZDPGSA-N |
| SMILES | CCCC=CC=CC(=O)OC1CC2C(CCCCC(O)CCC)CCCC2NC1C |