4-Methylbenzenesulfonic anhydride structure
|
Common Name | 4-Methylbenzenesulfonic anhydride | ||
|---|---|---|---|---|
| CAS Number | 4124-41-8 | Molecular Weight | 326.388 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 478.0±48.0 °C at 760 mmHg | |
| Molecular Formula | C14H14O5S2 | Melting Point | 121-127 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 242.9±29.6 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4-Methylbenzenesulfonic anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 478.0±48.0 °C at 760 mmHg |
| Melting Point | 121-127 °C(lit.) |
| Molecular Formula | C14H14O5S2 |
| Molecular Weight | 326.388 |
| Flash Point | 242.9±29.6 °C |
| Exact Mass | 326.028259 |
| PSA | 94.27000 |
| LogP | 3.50 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | PDVFSPNIEOYOQL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 2585 8/PG 3 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904100000 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
A reagent-controlled SN2-glycosylation for the direct synthesis of β-linked 2-deoxy-sugars.
J. Am. Chem. Soc. , (2014) The efficient and stereoselective construction of glycosidic linkages remains one of the most formidable challenges in organic chemistry. This is especially true in cases such as β-linked deoxy-sugars... |
|
|
Palladium-catalyzed allylic alkenylation of allylic alcohols with n-butyl acrylate.
Chem. Commun. (Camb.) (19) , 2404-5, (2003) Various allylic alcohols reacted with n-butyl acrylate in the presence of p-toluenesulfonic anhydride and palladium catalysts to yield the corresponding n-butyl 2,5-dienoates with high regioselectivit... |
| 1,3-bis(4-methylphenyl)-1,1,3,3-tetraoxo-1λ,3λ-dithioxane |
| MFCD00008548 |
| 4-Toluenesulfonic anhydride |
| p-Toluenesulfonic Anhydride |
| EINECS 223-926-9 |
| (4-methylphenyl)sulfonyl 4-methylbenzenesulfonate |