Benzene,1-methyl-4-(phenylsulfonyl) structure
|
Common Name | Benzene,1-methyl-4-(phenylsulfonyl) | ||
|---|---|---|---|---|
| CAS Number | 640-57-3 | Molecular Weight | 232.29800 | |
| Density | 1.196g/cm3 | Boiling Point | 387.9ºC at 760 mmHg | |
| Molecular Formula | C13H12O2S | Melting Point | 127-129ºC | |
| MSDS | N/A | Flash Point | 229.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(benzenesulfonyl)-4-methylbenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 387.9ºC at 760 mmHg |
| Melting Point | 127-129ºC |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.29800 |
| Flash Point | 229.7ºC |
| Exact Mass | 232.05600 |
| PSA | 42.52000 |
| LogP | 3.90860 |
| Index of Refraction | 1.583 |
| InChIKey | YBRXHRWLEFCFEG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)c2ccccc2)cc1 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S22-S24/25 |
| HS Code | 2904100000 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 7 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-phenylsulfonyltoluene |
| 4-Methyldiphenylsulfone |
| Phenyl p-tolyl sulfone |
| p-methylphenyl phenyl sulfone |
| EINECS 211-364-7 |
| 4-methyldiphenylsulphone |
| Sulfone,phenyl p-tolyl |
| p-Tolyl phenyl sulfone |
| 1-Benzenesulfonyl-4-methyl-benzene |
| 4-methylphenyl phenyl sulfone |
| MFCD00025038 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the safety information for 1-(benzenesulfonyl)-4-methylbenzene? |
| A: Safety information for 1-(benzenesulfonyl)-4-methylbenzene: S22-S24/25. |
| Q: What are the downstream products of 1-(benzenesulfonyl)-4-methylbenzene? |
| A: Related downstream products(CAS) of 1-(benzenesulfonyl)-4-methylbenzene: 536-57-2;5361-54-6;3699-01-2;16426-10-1;7705-63-7;66-39-7;83859-32-9. |
| Q: What is the molecular formula of 1-(benzenesulfonyl)-4-methylbenzene? |
| A: Molecular formula of 1-(benzenesulfonyl)-4-methylbenzene is C13H12O2S. |
| Q: What is the boiling point of 1-(benzenesulfonyl)-4-methylbenzene? |
| A: Boiling point of 1-(benzenesulfonyl)-4-methylbenzene is 387.9ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 1-(benzenesulfonyl)-4-methylbenzene? |
| A: Polar surface area (PSA) of 1-(benzenesulfonyl)-4-methylbenzene is 42.52000. |
| Q: What is the InChIKey of 1-(benzenesulfonyl)-4-methylbenzene? |
| A: InChIKey of 1-(benzenesulfonyl)-4-methylbenzene is YBRXHRWLEFCFEG-UHFFFAOYSA-N. |
| Q: What is the LogP of 1-(benzenesulfonyl)-4-methylbenzene? |
| A: LogP of 1-(benzenesulfonyl)-4-methylbenzene is 3.90860. |
| Q: What is the melting point of 1-(benzenesulfonyl)-4-methylbenzene? |
| A: Melting point of 1-(benzenesulfonyl)-4-methylbenzene is 127-129ºC. |
| Q: What is the SMILES notation of 1-(benzenesulfonyl)-4-methylbenzene? |
| A: SMILES notation of 1-(benzenesulfonyl)-4-methylbenzene is Cc1ccc(S(=O)(=O)c2ccccc2)cc1. |
| Q: What is the molecular weight of 1-(benzenesulfonyl)-4-methylbenzene? |
| A: Molecular weight of 1-(benzenesulfonyl)-4-methylbenzene is 232.29800. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |