(3-carbonochloridoyloxyphenyl) carbonochloridate structure
|
Common Name | (3-carbonochloridoyloxyphenyl) carbonochloridate | ||
|---|---|---|---|---|
| CAS Number | 4124-99-6 | Molecular Weight | 235.02100 | |
| Density | 1.521g/cm3 | Boiling Point | 277.4ºC at 760 mmHg | |
| Molecular Formula | C8H4Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.3ºC | |
| Name | (3-carbonochloridoyloxyphenyl) carbonochloridate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.521g/cm3 |
|---|---|
| Boiling Point | 277.4ºC at 760 mmHg |
| Molecular Formula | C8H4Cl2O4 |
| Molecular Weight | 235.02100 |
| Flash Point | 117.3ºC |
| Exact Mass | 233.94900 |
| PSA | 52.60000 |
| LogP | 3.16180 |
| Index of Refraction | 1.552 |
| InChIKey | RWMPEXNWGIVMEN-UHFFFAOYSA-N |
| SMILES | O=C(Cl)Oc1cccc(OC(=O)Cl)c1 |
| HS Code | 2916399090 |
|---|
|
~%
(3-carbonochlor... CAS#:4124-99-6 |
| Literature: Oesper; Broker; Cook Journal of the American Chemical Society, 1925 , vol. 47, p. 2609 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| m-Phenylene chloroformate |
| 1,3-Bis-chlorcarbonyloxy-benzol |
| Formic acid,chloro-,m-phenylene ester |
| benzene-1,3-dichloroformate |
| m-Phenylenbischlorcarbonat |
| m-Phenylendichlorformiat |
| Resorcin-O.O-dicarbonsaeure-dichlorid |
| 1,3-bis-chlorocarbonyloxy-benzene |