(4-carbonochloridoyloxyphenyl) carbonochloridate structure
|
Common Name | (4-carbonochloridoyloxyphenyl) carbonochloridate | ||
|---|---|---|---|---|
| CAS Number | 1885-20-7 | Molecular Weight | 235.02100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-carbonochloridoyloxyphenyl) carbonochloridate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H4Cl2O4 |
|---|---|
| Molecular Weight | 235.02100 |
| Exact Mass | 233.94900 |
| PSA | 52.60000 |
| LogP | 3.16180 |
| InChIKey | PVSUXIJGHWZIJA-UHFFFAOYSA-N |
| SMILES | O=C(Cl)Oc1ccc(OC(=O)Cl)cc1 |
| HS Code | 2916399090 |
|---|
|
~%
(4-carbonochlor... CAS#:1885-20-7 |
| Literature: Oesper; Broker; Cook Journal of the American Chemical Society, 1925 , vol. 47, p. 2609 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,4-bis-chlorocarbonyloxy-benzene |
| Hydrochinon-O.O-dicarbonsaeure-dichlorid |
| hydroquinone bischloroformate |
| p-phenylene bischloroformate |
| 1,4-Bis-chlorcarbonyloxy-benzol |
| p-Phenylen-bis-chlorformiat |