N-diphenylphosphinothioylaniline structure
|
Common Name | N-diphenylphosphinothioylaniline | ||
|---|---|---|---|---|
| CAS Number | 4129-41-3 | Molecular Weight | 309.36500 | |
| Density | 1.22g/cm3 | Boiling Point | 444.4ºC at 760 mmHg | |
| Molecular Formula | C18H16NPS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.6ºC | |
| Name | Diphenylthiophosphinsaeure-anilid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 444.4ºC at 760 mmHg |
| Molecular Formula | C18H16NPS |
| Molecular Weight | 309.36500 |
| Flash Point | 222.6ºC |
| Exact Mass | 309.07400 |
| PSA | 53.93000 |
| LogP | 4.86760 |
| Index of Refraction | 1.665 |
| InChIKey | GPVKWTVVLUPNCD-UHFFFAOYSA-N |
| SMILES | S=P(Nc1ccccc1)(c1ccccc1)c1ccccc1 |
| HS Code | 2930909090 |
|---|
|
~%
N-diphenylphosp... CAS#:4129-41-3 |
| Literature: Spence,R.A. et al. Australian Journal of Chemistry, 1969 , vol. 22, p. 2359 - 2370 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Phenyl-P,P-diphenyl-thiophosphinigsaeure-amid |
| diphenyl-thiophosphinic acid anilide |
| (Phenylamino)diphenylphosphine sulfide |
| Diphenyl-thiophosphinyl-anilid |