5,6-Dimethoxy-3,3-dimethyl-1-indanone structure
|
Common Name | 5,6-Dimethoxy-3,3-dimethyl-1-indanone | ||
|---|---|---|---|---|
| CAS Number | 4136-26-9 | Molecular Weight | 220.264 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 351.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | 69-70°C | |
| MSDS | N/A | Flash Point | 157.4±14.3 °C | |
| Name | 5,6-Dimethoxy-3,3-dimethyl-2,3-dihydro-1H-inden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 351.2±42.0 °C at 760 mmHg |
| Melting Point | 69-70°C |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.264 |
| Flash Point | 157.4±14.3 °C |
| Exact Mass | 220.109940 |
| PSA | 35.53000 |
| LogP | 3.29 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | KYEDLQFODOWDRO-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C(C)(C)CC2=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5,6-Dimethoxy-3,3-dimethyl-1-indanone |
| 5,6-dimethoxy-3,3-dimethyl-2H-inden-1-one |
| 1H-Inden-1-one, 2,3-dihydro-5,6-dimethoxy-3,3-dimethyl- |