Benzenesulfonic acid, 3-nitro-, phenyl ester structure
|
Common Name | Benzenesulfonic acid, 3-nitro-, phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 41480-04-0 | Molecular Weight | 279.26900 | |
| Density | 1.432g/cm3 | Boiling Point | 449.5ºC at 760 mmHg | |
| Molecular Formula | C12H9NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.6ºC | |
| Name | Phenyl 3-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432g/cm3 |
|---|---|
| Boiling Point | 449.5ºC at 760 mmHg |
| Molecular Formula | C12H9NO5S |
| Molecular Weight | 279.26900 |
| Flash Point | 225.6ºC |
| Exact Mass | 279.02000 |
| PSA | 97.57000 |
| LogP | 3.96650 |
| Index of Refraction | 1.615 |
| InChIKey | ISRIIYJVEICKKW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)Oc2ccccc2)c1 |
| HS Code | 2906299090 |
|---|
|
~%
Benzenesulfonic... CAS#:41480-04-0 |
| Literature: Vizgert, R.V.; Maksimenko, N.N.; Rubleva, L.I. Journal of Organic Chemistry USSR (English Translation), 1987 , vol. 23, # 11 p. 2144 - 2146 Zhurnal Organicheskoi Khimii, 1987 , vol. 23, # 11 p. 2429 - 2431 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| m-Nitrobenzolsulfonsaeurephenylester |
| Benzenesulfonic acid,3-nitro-,phenyl ester |
| Phenyl-m-nitrobenzolsulfonat |
| 3-nitro-benzenesulfonic acid phenyl ester |
| m-Nitrobenzenesulfonic acid,phenyl ester |
| 3-Nitro-benzolsulfonsaeure-phenylester |