1-(benzenesulfonyloxy)-2-methyl-benzene structure
|
Common Name | 1-(benzenesulfonyloxy)-2-methyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 41480-08-4 | Molecular Weight | 248.29800 | |
| Density | 1.245g/cm3 | Boiling Point | 390.9ºC at 760 mmHg | |
| Molecular Formula | C13H12O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.2ºC | |
| Name | (2-methylphenyl) benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 390.9ºC at 760 mmHg |
| Molecular Formula | C13H12O3S |
| Molecular Weight | 248.29800 |
| Flash Point | 190.2ºC |
| Exact Mass | 248.05100 |
| PSA | 51.75000 |
| LogP | 3.84350 |
| Index of Refraction | 1.583 |
| InChIKey | CCAQUIZLJKHKPH-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1OS(=O)(=O)c1ccccc1 |
|
~93%
1-(benzenesulfo... CAS#:41480-08-4 |
| Literature: Olivera, Roberto; SanMartin, Raul; Churruca, Fatima; Dominguez, Esther Journal of Organic Chemistry, 2002 , vol. 67, # 21 p. 7215 - 7225 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Benzolsulfonsaeure-o-tolylester |
| o-cresyl benzenesulfonate |
| benzenesulfonic acid o-tolyl ester |
| 2-Benzolsulfonyloxy-toluol |
| o-tolyl benzenesulfonate |
| 2-methylphenyl benzenesulfonate |