1-(benzenesulfonyloxy)-2-nitro-benzene structure
|
Common Name | 1-(benzenesulfonyloxy)-2-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 91493-71-9 | Molecular Weight | 279.26900 | |
| Density | 1.432g/cm3 | Boiling Point | 456.4ºC at 760 mmHg | |
| Molecular Formula | C12H9NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.8ºC | |
| Name | (2-nitrophenyl) benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432g/cm3 |
|---|---|
| Boiling Point | 456.4ºC at 760 mmHg |
| Molecular Formula | C12H9NO5S |
| Molecular Weight | 279.26900 |
| Flash Point | 229.8ºC |
| Exact Mass | 279.02000 |
| PSA | 97.57000 |
| LogP | 3.96650 |
| Index of Refraction | 1.615 |
| InChIKey | CWTHJALFQKJYBW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1OS(=O)(=O)c1ccccc1 |
|
~%
1-(benzenesulfo... CAS#:91493-71-9 |
| Literature: Raiford; Shelton Journal of the American Chemical Society, 1943 , vol. 65, p. 2048 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phenyl-sulfonsaeure-<2-nitro-phenylester> |
| 2-Nitrophenyl-benzolsulfonat |
| PhSO3H-2NO2Ph Salt |
| 2-Nitrophenyl benzenesulfonate |