N-(4-acetylaminophenyl)-3-hydroxynaphthalene-2-carboxamide structure
|
Common Name | N-(4-acetylaminophenyl)-3-hydroxynaphthalene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 41506-62-1 | Molecular Weight | 320.34200 | |
| Density | 1.369g/cm3 | Boiling Point | 526.2ºC at 760 mmHg | |
| Molecular Formula | C19H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272ºC | |
| Name | N-(4-acetamidophenyl)-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 526.2ºC at 760 mmHg |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.34200 |
| Flash Point | 272ºC |
| Exact Mass | 320.11600 |
| PSA | 78.43000 |
| LogP | 3.90210 |
| Index of Refraction | 1.744 |
| InChIKey | MSRUOXBBGPWHEG-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cc3ccccc3cc2O)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 255-419-3 |
| N-(4-Acetylaminophenyl)-3-hydroxynaphthalene-2-carboxamide |
| 1-acetylamino-4-(3-hydroxy-[2]naphthoylamino)-benzene |
| 1-Acetylamino-4-(3-hydroxy-[2]naphthoylamino)-benzol |