(4-chloro-2-nitrophenyl) thiohypochlorite structure
|
Common Name | (4-chloro-2-nitrophenyl) thiohypochlorite | ||
|---|---|---|---|---|
| CAS Number | 4153-06-4 | Molecular Weight | 224.06500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-chloro-2-nitrophenyl) thiohypochlorite |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H3Cl2NO2S |
|---|---|
| Molecular Weight | 224.06500 |
| Exact Mass | 222.92600 |
| PSA | 71.12000 |
| LogP | 4.01730 |
| InChIKey | ZJYRTZGGVYCECG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1SCl |
| HS Code | 2930909090 |
|---|
|
~%
(4-chloro-2-nit... CAS#:4153-06-4 |
| Literature: Zincke Justus Liebigs Annalen der Chemie, 1918 , vol. 416, p. 103 |
|
~%
(4-chloro-2-nit... CAS#:4153-06-4 |
| Literature: Brown,C. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1979 , p. 427 - 434 |
|
~%
(4-chloro-2-nit... CAS#:4153-06-4 |
| Literature: Beaulieu, Pierre L.; Kabo, Ann; Garratt, Dennis G. Canadian Journal of Chemistry, 1980 , vol. 58, p. 1014 - 1020 |
|
~%
(4-chloro-2-nit... CAS#:4153-06-4 |
| Literature: Zincke Justus Liebigs Annalen der Chemie, 1918 , vol. 416, p. 103 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| chloro-(4-chloro-2-nitro-phenyl)-sulfane |
| 2-nitro-4-chlorobenzenesulphenyl chloride |
| 4-Chlor-2-nitro-benzolsulfenylchlorid |
| 4-chloro-2-nitro-benzenesulfenyl chloride |
| 2-nitro-4-chlorobenzenesulfenyl chloride |
| Benzenesulfenyl chloride,4-chloro-2-nitro |
| 4-Chlor-2-nitro-benzol-sulfensaeure-(1)-chlorid |