2-(4-nitrophenoxy)-1-phenothiazin-10-ylethanone structure
|
Common Name | 2-(4-nitrophenoxy)-1-phenothiazin-10-ylethanone | ||
|---|---|---|---|---|
| CAS Number | 41648-57-1 | Molecular Weight | 378.40100 | |
| Density | 1.411g/cm3 | Boiling Point | 665.9ºC at 760mmHg | |
| Molecular Formula | C20H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 356.5ºC | |
| Name | 2-(4-nitrophenoxy)-1-phenothiazin-10-ylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 665.9ºC at 760mmHg |
| Molecular Formula | C20H14N2O4S |
| Molecular Weight | 378.40100 |
| Flash Point | 356.5ºC |
| Exact Mass | 378.06700 |
| PSA | 100.66000 |
| LogP | 5.39130 |
| InChIKey | UTHCEBFJXVQICL-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)N1c2ccccc2Sc2ccccc21 |
| HS Code | 2934300000 |
|---|
|
~79%
2-(4-nitropheno... CAS#:41648-57-1 |
| Literature: Chaurasia; Srivastava Journal of the Indian Chemical Society, 1991 , vol. 68, # 2 p. 106 - 107 |
|
~%
2-(4-nitropheno... CAS#:41648-57-1 |
| Literature: Chaurasia; Srivastava Journal of the Indian Chemical Society, 1991 , vol. 68, # 2 p. 106 - 107 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10-((4-Nitrophenoxy)acetyl)-10H-phenothiazine |
| T0514-9374 |
| 10H-Phenothiazine,10-((4-nitrophenoxy)acetyl) |