2-[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-phenothiazin-10-ylethanone structure
|
Common Name | 2-[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-phenothiazin-10-ylethanone | ||
|---|---|---|---|---|
| CAS Number | 54012-78-1 | Molecular Weight | 393.88900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16ClN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-phenothiazin-10-ylethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H16ClN3OS |
|---|---|
| Molecular Weight | 393.88900 |
| Exact Mass | 393.07000 |
| PSA | 70.00000 |
| LogP | 5.54890 |
| InChIKey | VBLQQONDXRNBOD-UHFFFAOYSA-N |
| SMILES | O=C(CNN=Cc1ccc(Cl)cc1)N1c2ccccc2Sc2ccccc21 |
|
~64%
2-[2-[(4-chloro... CAS#:54012-78-1 |
| Literature: Salvi, Vijay Kumar; Sharma, Shweta; Sharma, Chirag; Bhambi, Dinesh; Talesara Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2009 , vol. 48, # 11 p. 1583 - 1589 |
|
~%
2-[2-[(4-chloro... CAS#:54012-78-1 |
| Literature: El Kerdawy; Moharram; Tolba Journal fur Praktische Chemie, 1974 , vol. 316, # 3 p. 511 - 516 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 10-{[(4-chloro-benzylidene)-hydrazino]-acetyl}-10H-phenothiazine |
| 10-(4-(4-chlorobenzylidene)hydrazinoacetyl)phenothiazine |
| 10H-Phenothiazine,10-[[[(4-chlorophenyl)methylene]hydrazino]acetyl] |