2-Nitrodiphenylsulfide structure
|
Common Name | 2-Nitrodiphenylsulfide | ||
|---|---|---|---|---|
| CAS Number | 4171-83-9 | Molecular Weight | 231.270 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 343.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H9NO2S | Melting Point | 78-82 °C(lit.) | |
| MSDS | N/A | Flash Point | 161.4±23.2 °C | |
| Name | 2-Nitrophenyl phenyl sulfide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.3±25.0 °C at 760 mmHg |
| Melting Point | 78-82 °C(lit.) |
| Molecular Formula | C12H9NO2S |
| Molecular Weight | 231.270 |
| Flash Point | 161.4±23.2 °C |
| Exact Mass | 231.035400 |
| PSA | 71.12000 |
| LogP | 4.38 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | ZPWNCSAEXUDWTN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1Sc1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2930909090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-Nitrophenyl Phenyl Sulfide |
| 2-Nitrodiphenylsulfide |
| 1-nitro-2-phenylsulfanylbenzene |
| Sulfide, o-nitrophenyl phenyl |
| 2-Nitrodiphenyl Sulfide |
| 1-Nitro-2-(phenylsulfanyl)benzene |
| 1-Nitro-2-(phenylthio)benzene |
| MFCD00100508 |