2-(4-benzoylphenoxy)-1-piperidin-1-ylethanone
Modify Date: 2025-09-01 18:55:48
2-(4-benzoylphenoxy)-1-piperidin-1-ylethanone structure
|
Common Name | 2-(4-benzoylphenoxy)-1-piperidin-1-ylethanone | ||
|---|---|---|---|---|
| CAS Number | 42017-83-4 | Molecular Weight | 323.38600 | |
| Density | 1.174g/cm3 | Boiling Point | 533.5ºC at 760 mmHg | |
| Molecular Formula | C20H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.4ºC | |
| Name | 2-(4-benzoylphenoxy)-1-piperidin-1-ylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 533.5ºC at 760 mmHg |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.38600 |
| Flash Point | 276.4ºC |
| Exact Mass | 323.15200 |
| PSA | 46.61000 |
| LogP | 3.24680 |
| Index of Refraction | 1.582 |
| InChIKey | KQYSIFIPXCMPLJ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(OCC(=O)N2CCCCC2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzophenone,4-piperidinocarbonylmethoxy |