2-[4-(4-chlorobenzoyl)phenoxy]acetic acid structure
|
Common Name | 2-[4-(4-chlorobenzoyl)phenoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 42017-94-7 | Molecular Weight | 290.69800 | |
| Density | 1.354g/cm3 | Boiling Point | 482.9ºC at 760 mmHg | |
| Molecular Formula | C15H11ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.9ºC | |
| Name | 2-[4-(4-chlorobenzoyl)phenoxy]acetic acid |
|---|
| Density | 1.354g/cm3 |
|---|---|
| Boiling Point | 482.9ºC at 760 mmHg |
| Molecular Formula | C15H11ClO4 |
| Molecular Weight | 290.69800 |
| Flash Point | 245.9ºC |
| Exact Mass | 290.03500 |
| PSA | 63.60000 |
| LogP | 3.03440 |
| Index of Refraction | 1.603 |
| InChIKey | VXEQLPQDVNSOPB-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
2-[4-(4-chlorob... CAS#:42017-94-7 |
| Literature: Massolini; Carmellino; Baruffini Farmaco, Edizione Scientifica, 1986 , vol. 41, # 5 p. 381 - 387 |
|
~%
2-[4-(4-chlorob... CAS#:42017-94-7 |
| Literature: Massolini; Carmellino; Baruffini Farmaco, Edizione Scientifica, 1986 , vol. 41, # 5 p. 381 - 387 |
|
~%
2-[4-(4-chlorob... CAS#:42017-94-7 |
| Literature: Massolini; Carmellino; Baruffini Farmaco, Edizione Scientifica, 1986 , vol. 41, # 5 p. 381 - 387 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |