Ethyl (9Z,11E,13E)-9,11,13-octadecatrienoate structure
|
Common Name | Ethyl (9Z,11E,13E)-9,11,13-octadecatrienoate | ||
|---|---|---|---|---|
| CAS Number | 42021-86-3 | Molecular Weight | 306.483 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 401.1±24.0 °C at 760 mmHg | |
| Molecular Formula | C20H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.2±21.2 °C | |
| Name | 9(Z),11(E),13(E)-Octadecatrienoic Acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 401.1±24.0 °C at 760 mmHg |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.483 |
| Flash Point | 107.2±21.2 °C |
| Exact Mass | 306.255890 |
| PSA | 26.30000 |
| LogP | 7.66 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.475 |
| InChIKey | YVGCHYVFHLTZIM-CPIUXLSQSA-N |
| SMILES | CCCCC=CC=CC=CCCCCCCCC(=O)OCC |
| Storage condition | -20°C |
|
~%
Ethyl (9Z,11E,1... CAS#:42021-86-3 |
| Literature: Bergel'son,L.D. et al. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1963 , p. 611 - 614 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1963 , p. 683 - 687 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 9,11,13-Octadecatrienoic acid, ethyl ester, (9Z,11E,13E)- |
| Octadeca-9c,11t,13t-triensaeure-aethylester |
| octadeca-9c,11t,13t-trienoic acid ethyl ester |
| 9.15-Octadecadiinoinsaeure |
| Ethyl (9Z,11E,13E)-9,11,13-octadecatrienoate |
| Octadeca-9,15-diynsaeure |
| Octadeca-9c,11t,13t-triensaeureethylester |
| 9,15-Octadecadiynoic acid |