6,8-Dibrom-4-oxo-4H-chromen-3-carbaldehyde structure
|
Common Name | 6,8-Dibrom-4-oxo-4H-chromen-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 42059-76-7 | Molecular Weight | 331.94500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H4Br2O3 | Melting Point | 174-176ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 6,8-Dibrom-4-oxo-4H-chromen-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 174-176ºC(lit.) |
|---|---|
| Molecular Formula | C10H4Br2O3 |
| Molecular Weight | 331.94500 |
| Exact Mass | 329.85300 |
| PSA | 47.28000 |
| LogP | 3.13050 |
| InChIKey | XTEURQCXJDIUCR-UHFFFAOYSA-N |
| SMILES | O=Cc1coc2c(Br)cc(Br)cc2c1=O |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Risk Phrases | 25 |
| Safety Phrases | 45 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2914700090 |
|
~97%
6,8-Dibrom-4-ox... CAS#:42059-76-7 |
| Literature: Su; Li; Zhao Organic Preparations and Procedures International, 2007 , vol. 39, # 5 p. 495 - 502 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Biological activity of 3-formylchromones and related compounds.
In Vivo 21(5) , 829-34, (2007) Several 3-formylchromone derivatives were examined for their tumor cell-cytotoxic, anti-Helicobacter pylori, urease inhibitory and anti-HIV activity. Comparing their relative cytotoxicity against four... |
|
|
Crystal structure of (3,5-di-chloro-2-hy-droxy-phen-yl){1-[(naphthalen-1-yl)carbon-yl]-1H-pyrazol-4-yl}methanone.
Acta Crystallogr. Sect. E Struct. Rep. Online 70(12) , 522-24, (2014) The title compound, C21H12Cl2N2O3, is a 1,4-diaroyl pyrazole derivative and has three aromatic rings. The dihedral angles between the naphthalene ring system and the pyrazole ring, the pyrazole and ph... |
| 6,8-dibromo-2-thioxo-2,3-dihydro-4H-1,3-benzoxazin-4-one |
| 6,8-Dibromo-dihydro-1,3-benzoxazine-2-thione-4-one |
| 6,8-dibromo-4-oxo-4H-1-benzopyran-3-carboxaldehyde |