4-prop-2-enoxynaphthalene-1,2-dione structure
|
Common Name | 4-prop-2-enoxynaphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 42164-68-1 | Molecular Weight | 214.21700 | |
| Density | 1.22g/cm3 | Boiling Point | 379.2ºC at 760 mmHg | |
| Molecular Formula | C13H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.6ºC | |
| Name | 4-prop-2-enoxynaphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 379.2ºC at 760 mmHg |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.21700 |
| Flash Point | 170.6ºC |
| Exact Mass | 214.06300 |
| PSA | 43.37000 |
| LogP | 1.99550 |
| Index of Refraction | 1.584 |
| InChIKey | ZNCUVIUEUCWBPS-UHFFFAOYSA-N |
| SMILES | C=CCOC1=CC(=O)C(=O)c2ccccc21 |
|
~53%
4-prop-2-enoxyn... CAS#:42164-68-1 |
| Literature: Takuwa, Akio; Soga, Osamu; Iwamoto, Hidetoshi; Maruyama, Kazuhiro Bulletin of the Chemical Society of Japan, 1986 , vol. 59, # 9 p. 2959 - 2961 |
|
~41%
4-prop-2-enoxyn... CAS#:42164-68-1 |
| Literature: Nelson; Bartels; Bednarski; Zhang; Messick; Horng; Ruffolo Jr. Journal of Medicinal Chemistry, 1984 , vol. 27, # 7 p. 857 - 861 |
| 4-Allyloxy-[1,2]naphthoquinone |
| 4-(allyloxy)-1,2-naphthalenedione |
| 4-Allyloxy-1,2-naphthochinon |
| 4-allyloxy-naphthalene-1,2-dione |