2'-Hydroxy-2-methoxychalcone structure
|
Common Name | 2'-Hydroxy-2-methoxychalcone | ||
|---|---|---|---|---|
| CAS Number | 42220-77-9 | Molecular Weight | 254.28100 | |
| Density | 1.197g/cm3 | Boiling Point | 430.6ºC at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | 112-113ºC | |
| MSDS | N/A | Flash Point | 161.1ºC | |
Use of 2'-Hydroxy-2-methoxychalcone2'-Hydroxy-2-methoxychalcone (compound 3b) is a synthetic chalcone, with antimicrobial activity[1]. |
| Name | 2'-hydroxy-2-methoxychalcone |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-Hydroxy-2-methoxychalcone (compound 3b) is a synthetic chalcone, with antimicrobial activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 430.6ºC at 760 mmHg |
| Melting Point | 112-113ºC |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 161.1ºC |
| Exact Mass | 254.09400 |
| PSA | 46.53000 |
| LogP | 3.29690 |
| Index of Refraction | 1.631 |
| InChIKey | SNTIPKTZVAKPOX-ZHACJKMWSA-N |
| SMILES | COc1ccccc1C=CC(=O)c1ccccc1O |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2914509090 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (2E)-1-(2-hydroxyphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one |
| 1-(2-HYDROXYPHENYL)-3-(2-METHOXYPHENYL)PROP-2-EN-1-ONE |
| (E)-1-(2-hydroxyphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one |
| [E]-3-(o-methoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one |
| 2'-FORMYL-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID |
| 2-Propen-1-one, 1-(2-hydroxyphenyl)-3-(2-methoxyphenyl)- |