N,N-dibenzyl-2,2-dichloro-acetamide structure
|
Common Name | N,N-dibenzyl-2,2-dichloro-acetamide | ||
|---|---|---|---|---|
| CAS Number | 42277-06-5 | Molecular Weight | 308.20200 | |
| Density | 1.265g/cm3 | Boiling Point | 438.6ºC at 760 mmHg | |
| Molecular Formula | C16H15Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219ºC | |
| Name | N,N-dibenzyl-2,2-dichloroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 438.6ºC at 760 mmHg |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.20200 |
| Flash Point | 219ºC |
| Exact Mass | 307.05300 |
| PSA | 20.31000 |
| LogP | 4.01910 |
| Index of Refraction | 1.597 |
| InChIKey | CMCPFKOSYLCNHR-UHFFFAOYSA-N |
| SMILES | O=C(C(Cl)Cl)N(Cc1ccccc1)Cc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
N,N-dibenzyl-2,... CAS#:42277-06-5 |
| Literature: Thommes, Katrin; Kiefer, Gregor; Scopelliti, Rosario; Severin, Kay Angewandte Chemie - International Edition, 2009 , vol. 48, # 43 p. 8115 - 8119 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Dichlor-essigsaeure-dibenzylamid |
| N,N-DIBENZYL-2,2-DICHLORO-ACETAMIDE |
| dichloro-acetic acid dibenzylamide |