Diferuloylputrescine structure
|
Common Name | Diferuloylputrescine | ||
|---|---|---|---|---|
| CAS Number | 42369-86-8 | Molecular Weight | 440.48900 | |
| Density | 1.24g/cm3 | Boiling Point | 765.7ºC at 760mmHg | |
| Molecular Formula | C24H28N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 416.9ºC | |
Use of DiferuloylputrescineN,N′-Diferuloylputrescine is a inhibitor of pigmentation with 57% reduction. N,N′-Diferuloylputrescine significantly reduces the protein level of MITF. N,N′-Diferuloylputrescine has strong antioxidant activities as radical scavengers against reactive oxygen species[1]. |
| Name | (E)-3-(4-hydroxy-3-methoxyphenyl)-N-[4-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]butyl]prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Description | N,N′-Diferuloylputrescine is a inhibitor of pigmentation with 57% reduction. N,N′-Diferuloylputrescine significantly reduces the protein level of MITF. N,N′-Diferuloylputrescine has strong antioxidant activities as radical scavengers against reactive oxygen species[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 765.7ºC at 760mmHg |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.48900 |
| Flash Point | 416.9ºC |
| Exact Mass | 440.19500 |
| PSA | 124.10000 |
| LogP | 4.53480 |
| Index of Refraction | 1.622 |
| InChIKey | CHEMZHJQHCVLFI-MKICQXMISA-N |
| SMILES | COc1cc(C=CC(=O)NCCCCNC(=O)C=Cc2ccc(O)c(OC)c2)ccc1O |
|
~72%
Diferuloylputrescine CAS#:42369-86-8 |
| Literature: Mahanta, Dhrubajyoti; Handique, Jyotirekha G. Letters in Organic Chemistry, 2011 , vol. 8, # 9 p. 618 - 624 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Bis-ferulamidobutane |
| (E,E)-Terrestribisamide |
| Terrestribisamide,(E,E) |
| N,N'-Diferuloylputrescine |
| Terrestribisamide |
| Sid Corn DFP |
| AC1NT0V6 |
| UNII-576NVQ5724 |
| trans-N,N'-Diferuloylputrescine |
| Diferuloylputrescine |