Ethanone,2-hydroxy-1,2,2-triphenyl structure
|
Common Name | Ethanone,2-hydroxy-1,2,2-triphenyl | ||
|---|---|---|---|---|
| CAS Number | 4237-46-1 | Molecular Weight | 288.34000 | |
| Density | 1.186g/cm3 | Boiling Point | 465.8ºC at 760 mmHg | |
| Molecular Formula | C20H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.1ºC | |
| Name | 2-hydroxy-1,2,2-triphenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 465.8ºC at 760 mmHg |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.34000 |
| Flash Point | 198.1ºC |
| Exact Mass | 288.11500 |
| PSA | 37.30000 |
| LogP | 3.80540 |
| Index of Refraction | 1.627 |
| InChIKey | CKKQLOUBFINSIB-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Benzoyldiphenylmethanol |
| diphenyl benzoyl methanol |
| 2-hydroxy-2,2-diphenylacetophenone |
| 2-hydroxy-1,2,2-triphenylethan-1-one |
| phenylbenzoin |