Benzeneacetic acid, a-hydroxy-4-methoxy-a-phenyl- structure
|
Common Name | Benzeneacetic acid, a-hydroxy-4-methoxy-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 4237-50-7 | Molecular Weight | 258.26900 | |
| Density | 1.276g/cm3 | Boiling Point | 448.5ºC at 760 mmHg | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.9ºC | |
| Name | 2-hydroxy-2-(4-methoxyphenyl)-2-phenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 448.5ºC at 760 mmHg |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.26900 |
| Flash Point | 169.9ºC |
| Exact Mass | 258.08900 |
| PSA | 66.76000 |
| LogP | 2.01570 |
| Index of Refraction | 1.603 |
| InChIKey | KWRLXQHDQNHPLW-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)(C(=O)O)c2ccccc2)cc1 |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4'-Methoxybenzilic Acid |
| 4-Methoxy-benzilsaeure |
| Hydroxy(4-methoxyphenyl)phenylacetic acid |