ethenyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate structure
|
Common Name | ethenyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 42409-05-2 | Molecular Weight | 326.13700 | |
| Density | 1.7 g/mL at 20ºC(lit.) | Boiling Point | N/A | |
| Molecular Formula | C6H3F9O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethenyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7 g/mL at 20ºC(lit.) |
|---|---|
| Molecular Formula | C6H3F9O3S |
| Molecular Weight | 326.13700 |
| Exact Mass | 325.96600 |
| PSA | 51.75000 |
| LogP | 3.98280 |
| InChIKey | SZQVETPSXXBSDR-UHFFFAOYSA-N |
| SMILES | C=COS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| HS Code | 2905290000 |
|
~74%
ethenyl 1,1,2,2... CAS#:42409-05-2 |
| Literature: Lyapkalo, Ilya M.; Webel, Matthias; Reissig, Hans-Ulrich European Journal of Organic Chemistry, 2001 , # 22 p. 4189 - 4194 |
|
~64%
ethenyl 1,1,2,2... CAS#:42409-05-2 |
| Literature: Lyapkalo, Ilya M.; Webel, Matthias; Reissig, Hans-Ulrich European Journal of Organic Chemistry, 2001 , # 22 p. 4189 - 4194 |
| HS Code | 2905290000 |
|---|---|
| Summary | 2905290000 unsaturated monohydric alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Vinyl perfluoro-1-butanesulfonate |
| vinyl nonaflate |
| Vinyl nonafluoro-1-butanesulfonate |
| ethenyl nonaflate |
| Ethenyl nonafluoro-1-butanesulfonate |
| Vinylnonaflat |
| Vinylnonafluorobutanesulfonate |