2-cyclohexyl-1,3-oxazole-4,5-dicarboxamide structure
|
Common Name | 2-cyclohexyl-1,3-oxazole-4,5-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 42469-64-7 | Molecular Weight | 237.25500 | |
| Density | 1.289g/cm3 | Boiling Point | 503.8ºC at 760 mmHg | |
| Molecular Formula | C11H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.5ºC | |
| Name | 2-cyclohexyl-1,3-oxazole-4,5-dicarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 503.8ºC at 760 mmHg |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.25500 |
| Flash Point | 258.5ºC |
| Exact Mass | 237.11100 |
| PSA | 114.19000 |
| LogP | 2.68850 |
| Index of Refraction | 1.569 |
| InChIKey | HKAGDNVPJOFQKY-UHFFFAOYSA-N |
| SMILES | NC(=O)c1nc(C2CCCCC2)oc1C(N)=O |
| HS Code | 2934999090 |
|---|
|
~%
2-cyclohexyl-1,... CAS#:42469-64-7 |
| Literature: Tarzia,G. et al. European Journal of Medicinal Chemistry, 1976 , vol. 11, p. 263 - 270 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5-Oxazoledicarboxamide,2-cyclohexyl |
| 2-cyclohexyl-oxazole-4,5-dicarboxylic acid diamide |
| 2-Cyclohexyl-4,5-oxazoldicarboxamid |
| 2-Cyclohexyl-4,5-oxazoledicarboxamide |