7-Nitro-9-oxo-9H-fluorene-4-carboxylic acid structure
|
Common Name | 7-Nitro-9-oxo-9H-fluorene-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 42523-38-6 | Molecular Weight | 269.20900 | |
| Density | 1.591g/cm3 | Boiling Point | 561.6ºC at 760 mmHg | |
| Molecular Formula | C14H7NO5 | Melting Point | 269-270ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 241.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 7-nitro-9-oxofluorene-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.591g/cm3 |
|---|---|
| Boiling Point | 561.6ºC at 760 mmHg |
| Melting Point | 269-270ºC(lit.) |
| Molecular Formula | C14H7NO5 |
| Molecular Weight | 269.20900 |
| Flash Point | 241.7ºC |
| Exact Mass | 269.03200 |
| PSA | 100.19000 |
| LogP | 3.02760 |
| Index of Refraction | 1.728 |
| InChIKey | QSYJYVBDMIMYCS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2c1-c1ccc([N+](=O)[O-])cc1C2=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| RTECS | LL6805000 |
| HS Code | 2918300090 |
|
~%
7-Nitro-9-oxo-9... CAS#:42523-38-6 |
| Literature: Moore; Huntress Journal of the American Chemical Society, 1927 , vol. 49, p. 1328 |
|
~%
7-Nitro-9-oxo-9... CAS#:42523-38-6 |
| Literature: Moore; Huntress Journal of the American Chemical Society, 1927 , vol. 49, p. 1328 |
|
~%
7-Nitro-9-oxo-9... CAS#:42523-38-6 |
| Literature: Moore; Huntress Journal of the American Chemical Society, 1927 , vol. 49, p. 1328 |
|
~%
7-Nitro-9-oxo-9... CAS#:42523-38-6 |
| Literature: Moore; Huntress Journal of the American Chemical Society, 1927 , vol. 49, p. 1328 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 7-nitro-9-oxo-fluorene-4-carboxylic acid |
| 7-Nitro-9-oxo-4-fluorenecarboxylic acid |
| 7-Nitro-9-oxo-9H-fluorene-4-carboxylic acid |
| 7-Nitro-9-oxo-fluoren-4-carbonsaeure |
| 7-Nitro-9-fluorenone-4-carboxylic acid |
| 2-Nitrofluorenone-5-carboxylic acid |
| MFCD00010784 |
| 9H-Fluorene-4-carboxylic acid,7-nitro-9-oxo |
| 7-Nitro-fluorenon-4-carbonsaeure |