WAY-311141-A structure
|
Common Name | WAY-311141-A | ||
|---|---|---|---|---|
| CAS Number | 425653-82-3 | Molecular Weight | 293.4 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 451.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C20H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.9±16.7 °C | |
Use of WAY-311141-Ainhibitors targeting enoyl-acyl carrier protein reductase |
| Name | WAY-311141-A |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.3±40.0 °C at 760 mmHg |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.4 |
| Flash Point | 170.9±16.7 °C |
| Exact Mass | 293.177979 |
| LogP | 4.24 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | QSJGQFJSVQPOPX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)CCN2CCC(c3ccccc3)C2)cc1.Cl |
| 1-(4-Methylphenyl)-3-(3-phenyl-1-pyrrolidinyl)-1-propanone |
| MFCD02578810 |
| 1-Propanone, 1-(4-methylphenyl)-3-(3-phenyl-1-pyrrolidinyl)- |
| 3-(3-Phenyl-pyrrolidin-1-yl)-1-p-tolyl-propan-1-one |