2,5-Bis(trifluoromethyl)benzoic acid structure
|
Common Name | 2,5-Bis(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 42580-42-7 | Molecular Weight | 258.11700 | |
| Density | 1.319g/cm3 | Boiling Point | 55.2ºC at 760mmHg | |
| Molecular Formula | C9H4F6O2 | Melting Point | 78-80 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,5-Bis(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.319g/cm3 |
|---|---|
| Boiling Point | 55.2ºC at 760mmHg |
| Melting Point | 78-80 °C(lit.) |
| Molecular Formula | C9H4F6O2 |
| Molecular Weight | 258.11700 |
| Exact Mass | 258.01200 |
| PSA | 37.30000 |
| LogP | 3.42240 |
| Index of Refraction | 1.424 |
| InChIKey | PINBPLCVZSKLTF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
|
~92%
2,5-Bis(trifluo... CAS#:42580-42-7 |
| Literature: Schlosser, Manfred; Mongin; Porwisiak, Jacek; Dmowski, Wojciech; Bueker, Heinz H.; Nibbering, Nico M. M. Chemistry - A European Journal, 1998 , vol. 4, # 7 p. 1281 - 1286 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,5-Bis(Trifluoromethyl)Benzoic Acid |
| 2,4-DICHLORO-5-NITRO-6-METHYLPYRIMIDINE |
| MFCD00013249 |