3-(4-ethoxyanilino)-3-oxopropanoic acid
Modify Date: 2025-10-24 19:30:17
3-(4-ethoxyanilino)-3-oxopropanoic acid structure
|
Common Name | 3-(4-ethoxyanilino)-3-oxopropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4270-38-6 | Molecular Weight | 223.22500 | |
| Density | 1.282g/cm3 | Boiling Point | 485.543ºC at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.448ºC | |
| Name | 3-(4-ethoxyanilino)-3-oxopropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 485.543ºC at 760 mmHg |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 247.448ºC |
| Exact Mass | 223.08400 |
| PSA | 75.63000 |
| LogP | 1.57150 |
| Index of Refraction | 1.581 |
| InChIKey | CLYZAEDHBXTZBW-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(NC(=O)CC(=O)O)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
3-(4-ethoxyanil... CAS#:4270-38-6 |
| Literature: Castellaneta Gazzetta Chimica Italiana, 1895 , vol. 25 II, p. 538,539 |
|
~%
3-(4-ethoxyanil... CAS#:4270-38-6 |
| Literature: Castellaneta Gazzetta Chimica Italiana, 1895 , vol. 25 II, p. 538,539 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Malonsaeure-mono-p-phenetidid |