3-((4-Nitrobenzyl)oxy)-3-oxopropanoic acid structure
|
Common Name | 3-((4-Nitrobenzyl)oxy)-3-oxopropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 77359-11-6 | Molecular Weight | 239.182 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 455.8±30.0 °C at 760 mmHg | |
| Molecular Formula | C10H9NO6 | Melting Point | 109 °C | |
| MSDS | N/A | Flash Point | 229.5±24.6 °C | |
| Name | 4-Nitrobenzyl hydrogen malonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 455.8±30.0 °C at 760 mmHg |
| Melting Point | 109 °C |
| Molecular Formula | C10H9NO6 |
| Molecular Weight | 239.182 |
| Flash Point | 229.5±24.6 °C |
| Exact Mass | 239.042984 |
| PSA | 109.42000 |
| LogP | 1.30 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | RIGFMUNSTCPGNP-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| Storage condition | 2~8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2918990090 |
|
~77%
3-((4-Nitrobenz... CAS#:77359-11-6 |
| Literature: Nippon Kayaku Kabushiki Kaisha Patent: US5516934 A1, 1996 ; |
|
~60%
3-((4-Nitrobenz... CAS#:77359-11-6 |
| Literature: Nippon Kayaku Kabushiki Kaisha Patent: US5087734 A1, 1992 ; |
|
~%
3-((4-Nitrobenz... CAS#:77359-11-6 |
| Literature: US4576746 A1, ; |
|
~64%
3-((4-Nitrobenz... CAS#:77359-11-6 |
| Literature: Bulman Page, Philip C; Moore, Jonathan P.G; Mansfield, Ian; McKenzie, Michael J; Bowler, Wayne B; Gallagher, James A Tetrahedron, 2001 , vol. 57, # 9 p. 1837 - 1847 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-[(4-Nitrobenzyl)oxy]-3-oxopropanoic acid |
| Mono p-nitro benzyl malonate |
| 3-[(4-nitrophenyl)methoxy]-3-oxopropanoic acid |
| MFCD00191556 |
| Propanedioic acid, mono[(4-nitrophenyl)methyl] ester |
| 4-Nitrobenzylhydrogenmalonate |