2-methyl-1,3-dioxoisoindole-5-carboxylic acid structure
|
Common Name | 2-methyl-1,3-dioxoisoindole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 42710-39-4 | Molecular Weight | 205.16700 | |
| Density | 1.518g/cm3 | Boiling Point | 422.4ºC at 760 mmHg | |
| Molecular Formula | C10H7NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 209.3ºC | |
| Name | 2-methyl-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.518g/cm3 |
|---|---|
| Boiling Point | 422.4ºC at 760 mmHg |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.16700 |
| Flash Point | 209.3ºC |
| Exact Mass | 205.03800 |
| PSA | 74.68000 |
| LogP | 0.54850 |
| Index of Refraction | 1.65 |
| InChIKey | JNOGAXDCJSTIRH-UHFFFAOYSA-N |
| SMILES | CN1C(=O)c2ccc(C(=O)O)cc2C1=O |
|
~%
2-methyl-1,3-di... CAS#:42710-39-4 |
| Literature: Takeda Chemical Industries, Ltd. Patent: EP1466625 A1, 2004 ; Location in patent: Page 164-165 ; |
|
~73%
2-methyl-1,3-di... CAS#:42710-39-4 |
| Literature: BOEHRINGER INGELHEIM PHARMA GMBH and CO. KG Patent: WO2004/26829 A2, 2004 ; Location in patent: Page/Page column 76 ; WO 2004/026829 A2 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Methyl-1,3-dioxo-5-isoindolinecarboxylic acid |
| 2-methyl-1,3-dioxo-1,3-dihydro-isoindole-5-carboxylic acid |
| 5-carboxy-2-methyl-isoindole-1,3-dione |
| 2-methyl-1,3-dioxoisoindoline-5-carboxylic acid |
| 2-methyl-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid |
| N-methyltrimellitic acid imide |