trimellitic anhydride structure
|
Common Name | trimellitic anhydride | ||
|---|---|---|---|---|
| CAS Number | 552-30-7 | Molecular Weight | 192.125 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 470.6±28.0 °C at 760 mmHg | |
| Molecular Formula | C9H4O5 | Melting Point | 163-166 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 201.3±17.5 °C | |
| Symbol |
GHS05, GHS07, GHS08 |
Signal Word | Danger | |
| Name | trimellitic anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 470.6±28.0 °C at 760 mmHg |
| Melting Point | 163-166 °C(lit.) |
| Molecular Formula | C9H4O5 |
| Molecular Weight | 192.125 |
| Flash Point | 201.3±17.5 °C |
| Exact Mass | 192.005875 |
| PSA | 80.67000 |
| LogP | 1.28 |
| Vapour density | 6.6 (vs air) |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | SRPWOOOHEPICQU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)OC2=O |
| Stability | Stable. Moisture sensitive. |
| Water Solubility | DECOMPOSES |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H318-H334-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P342 + P311 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R37;R41;R42/43 |
| Safety Phrases | S22-S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| RTECS | DC2050000 |
| HS Code | 29173980 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Skin sensitization induced Langerhans' cell mobilization: variable requirements for tumour necrosis factor-α.
Immunology 144(1) , 139-48, (2015) Upon antigen/allergen recognition, epidermal Langerhans' cells (LC) are mobilized and migrate to the local lymph node where they play a major role in initiating or regulating immune responses. It had ... |
|
|
Synthesis and properties of optically active nanostructured polymers bearing amino acid moieties by direct polycondensation of 4,4'-thiobis(2-tert-butyl-5-methylphenol) with chiral diacids.
Amino Acids 42(6) , 2187-94, (2012) Four derivatives of N-trimellitylimido-L-amino acid (4a-4d) were prepared by the reaction of trimellitic anhydride (1) with the L-amino acids (2a-2d) in acetic acid as diacid monomers and were used wi... |
|
|
A rare nail polish allergen: phthalic anhydride, trimellitic anhydride and glycols copolymer.
Contact Dermatitis 56(3) , 172-3, (2007)
|
| EINECS 209-008-0 |
| Anhydrosepedonin |
| 1,3-dioxo-1,3-dihydro-isobenzofuran-5-carboxylic acid |
| MFCD00005925 |
| Anhydrotrimellitic acid |
| 4-carboxyphthalic anhydride |
| 1,2,4-Benzenetricarboxylic anhydride |
| 1,3-dihydro-1,3-dioxo-5-isobenzofurancarboxylic acid |