bis(trifluoromethylsulphonyl)methane structure
|
Common Name | bis(trifluoromethylsulphonyl)methane | ||
|---|---|---|---|---|
| CAS Number | 428-76-2 | Molecular Weight | 280.16600 | |
| Density | 1.832g/cm3 | Boiling Point | 300.8ºC at 760mmHg | |
| Molecular Formula | C3H2F6O4S2 | Melting Point | 35ºC | |
| MSDS | N/A | Flash Point | 135.7ºC | |
| Name | Bis(trifluoromethanesulfonyl)methane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.832g/cm3 |
|---|---|
| Boiling Point | 300.8ºC at 760mmHg |
| Melting Point | 35ºC |
| Molecular Formula | C3H2F6O4S2 |
| Molecular Weight | 280.16600 |
| Flash Point | 135.7ºC |
| Exact Mass | 279.93000 |
| PSA | 85.04000 |
| LogP | 2.97470 |
| Vapour Pressure | 0.00195mmHg at 25°C |
| Index of Refraction | 1.366 |
| InChIKey | QBOFWVRRMVGXIG-UHFFFAOYSA-N |
| SMILES | O=S(=O)(CS(=O)(=O)C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2904909090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Bis(trifluoromethylsulfonyl)methane |
| trifluoro(trifluoromethylsulfonylmethylsulfonyl)methane |