2,2-bis(trifluoromethylsulfanyl)acetic acid structure
|
Common Name | 2,2-bis(trifluoromethylsulfanyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 84132-18-3 | Molecular Weight | 260.17800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H2F6O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-bis(trifluoromethylsulfanyl)acetic acid |
|---|
| Molecular Formula | C4H2F6O2S2 |
|---|---|
| Molecular Weight | 260.17800 |
| Exact Mass | 259.94000 |
| PSA | 87.90000 |
| LogP | 2.90310 |
| InChIKey | HVSJIIYXAMCXMX-UHFFFAOYSA-N |
| SMILES | O=C(O)C(SC(F)(F)F)SC(F)(F)F |
|
~70%
2,2-bis(trifluo... CAS#:84132-18-3 |
| Literature: Haas, A.; Lieb, M.; Praas, H.-Ww. Journal of Fluorine Chemistry, 1989 , vol. 44, p. 329 - 338 |
|
~52%
2,2-bis(trifluo... CAS#:84132-18-3 |
| Literature: Mendelson, Wilford L.; Liu, Jih-Hua; Killmer, Lewis B.; Levinson, Sidney H. Journal of Organic Chemistry, 1983 , vol. 48, # 3 p. 298 - 302 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |