1-(3-fluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde structure
|
Common Name | 1-(3-fluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 428497-01-2 | Molecular Weight | 217.23900 | |
| Density | 1.11g/cm3 | Boiling Point | 345.7ºC at 760 mmHg | |
| Molecular Formula | C13H12FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.9ºC | |
| Name | 1-(3-fluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
|---|
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 345.7ºC at 760 mmHg |
| Molecular Formula | C13H12FNO |
| Molecular Weight | 217.23900 |
| Flash Point | 162.9ºC |
| Exact Mass | 217.09000 |
| PSA | 22.00000 |
| LogP | 3.04570 |
| Index of Refraction | 1.548 |
| InChIKey | PLCBYAIRHPWRPH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C=O)c(C)n1-c1cccc(F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |