methylsilylidyne tris(trifluoroacetate)
Modify Date: 2025-08-31 17:30:02
methylsilylidyne tris(trifluoroacetate) structure
|
Common Name | methylsilylidyne tris(trifluoroacetate) | ||
|---|---|---|---|---|
| CAS Number | 429-72-1 | Molecular Weight | 382.16600 | |
| Density | 1.596g/cm3 | Boiling Point | 122.9ºC at 760mmHg | |
| Molecular Formula | C7H3F9O6Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 28.1ºC | |
| Name | [methyl-bis[(2,2,2-trifluoroacetyl)oxy]silyl] 2,2,2-trifluoroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.596g/cm3 |
|---|---|
| Boiling Point | 122.9ºC at 760mmHg |
| Molecular Formula | C7H3F9O6Si |
| Molecular Weight | 382.16600 |
| Flash Point | 28.1ºC |
| Exact Mass | 381.95600 |
| PSA | 78.90000 |
| LogP | 1.87160 |
| Vapour Pressure | 13.7mmHg at 25°C |
| Index of Refraction | 1.337 |
| InChIKey | MNUAXOMKLTTWDO-UHFFFAOYSA-N |
| SMILES | C[Si](OC(=O)C(F)(F)F)(OC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
|
~%
methylsilylidyn... CAS#:429-72-1 |
| Literature: Anderson; Fischer Journal of Organic Chemistry, 1954 , vol. 19, p. 1296,1298 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| EINECS 207-061-4 |
| Methyl-tris-trifluoracetoxy-silan |
| Methyltio-trifluoracetoxy-silan |