Cletoquine
Modify Date: 2025-08-25 17:16:32
Cletoquine structure
|
Common Name | Cletoquine | ||
|---|---|---|---|---|
| CAS Number | 4298-15-1 | Molecular Weight | 307.81800 | |
| Density | 1.212 g/cm3 | Boiling Point | 514.7ºC at 760 mmHg | |
| Molecular Formula | C16H22ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.1ºC | |
Use of CletoquineCletoquine (Desethylhydroxychloroquine) is a major active metabolite of Hydroxychloroquine. Cletoquine is produced in the liver by CYP2D6, CYP3A4, CYP3A5, and CYP2C8 isoenzymes. Cletoquine is also a Chloroquine derivative and has the ability to against the chikungunya virus (CHIKV). Cletoquine has antimalarial effects and has the potential for autoimmune diseases treatment[1][2]. |
| Name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Description | Cletoquine (Desethylhydroxychloroquine) is a major active metabolite of Hydroxychloroquine. Cletoquine is produced in the liver by CYP2D6, CYP3A4, CYP3A5, and CYP2C8 isoenzymes. Cletoquine is also a Chloroquine derivative and has the ability to against the chikungunya virus (CHIKV). Cletoquine has antimalarial effects and has the potential for autoimmune diseases treatment[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Chikungunya virus (CHIKV)[2] |
| In Vivo | Hydroxychloroquine (5 mg/kg intravenously) is administered to BALB/c mice for blood and tissue to determine the content of Cletoquine (Desethylhydroxychloroquine). The tissue to blood concentration ratio (Kp) is ≥1, indicating accumulation of Cletoquine in tissues. The Cletoquine Kp ratio for the various tissues are observed in the descending order of liver (114.3)>kidney (24.4)>spleen (19.3)>lungs (16.5)>heart (5.5)[3]. |
| References |
| Density | 1.212 g/cm3 |
|---|---|
| Boiling Point | 514.7ºC at 760 mmHg |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.81800 |
| Flash Point | 265.1ºC |
| Exact Mass | 307.14500 |
| PSA | 57.18000 |
| LogP | 3.51460 |
| Index of Refraction | 1.623 |
| InChIKey | XFICNUNWUREFDP-UHFFFAOYSA-N |
| SMILES | CC(CCCNCCO)Nc1ccnc2cc(Cl)ccc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Cletoquine [INN:BAN] |
| GNF-Pf-1952 |
| 2-({4-[(7-chloroquinolin-4-yl)amino]pentyl}amino)ethanol |
| Cletoquine |
| Cletoquina |
| Cletochina |
| Desethylhydroxychloroquine |
| Cletoquinum |
| Cletochina [DCIT] |