Deoxyshikonin structure
|
Common Name | Deoxyshikonin | ||
|---|---|---|---|---|
| CAS Number | 43043-74-9 | Molecular Weight | 272.296 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 503.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | 91ºC | |
| MSDS | N/A | Flash Point | 272.5±26.6 °C | |
Use of DeoxyshikoninDeoxyshikonin is isolated from Lithospermum erythrorhizon Sieb with antitumor activity. Deoxyshikonin increases the expression of VEGF-C and VEGF-A mRNA in HMVEC-dLy, promotes HIF-1α and HIF-1β subunit interaction and binds to specific DNA sequences targeted by HIF, indicates a prolymphangiogenesis as well as a proangiogenesis effect in vitro[1]. Deoxyshikonin shows significant synergic antimicrobial activity with tetracycline against S. pneumonia (MIC=17 μg/mL), also shows significantly inhibitory activities against MRSA[2]. |
| Name | 5,8-dihydroxy-2-(4-methylpent-3-enyl)naphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Deoxyshikonin is isolated from Lithospermum erythrorhizon Sieb with antitumor activity. Deoxyshikonin increases the expression of VEGF-C and VEGF-A mRNA in HMVEC-dLy, promotes HIF-1α and HIF-1β subunit interaction and binds to specific DNA sequences targeted by HIF, indicates a prolymphangiogenesis as well as a proangiogenesis effect in vitro[1]. Deoxyshikonin shows significant synergic antimicrobial activity with tetracycline against S. pneumonia (MIC=17 μg/mL), also shows significantly inhibitory activities against MRSA[2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 503.7±50.0 °C at 760 mmHg |
| Melting Point | 91ºC |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.296 |
| Flash Point | 272.5±26.6 °C |
| Exact Mass | 272.104858 |
| PSA | 74.60000 |
| LogP | 4.72 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | VOMDIEGPEURZJO-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC1=CC(=O)c2c(O)ccc(O)c2C1=O |
| Storage condition | 2-8C |
| Safety Phrases | 22-24/25 |
|---|---|
| HS Code | 2914690090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1'O-deoxyshikonin |
| ARNEBIN-7 |
| 5,8-Dihydroxy-2-(4-methyl-3-penten-1-yl)-1,4-naphthoquinone |
| deoxyalkannin |
| 5,8-Dihydroxy-2-(4-methyl-3-pentenyl)-1,4-naphthalenedione |
| 11-Deoxyalkannin |
| 1,4-Naphthalenedione, 5,8-dihydroxy-2-(4-methyl-3-pentenyl)- |
| 5,8-Dihydroxy-2-(4-methyl-pent-3-enyl)-1,4-naphthoquinone |
| 1,4-Naphthalenedione, 5,8-dihydroxy-2-(4-methyl-3-penten-1-yl)- |
| 5,8-Dihydroxy-2-(4-methyl-3-pentenyl)naphthoquinone |
| deoxyshikonin |
| 5,8-Dihydroxy-2-(4-methylpent-3-en-1-yl)-1,4-naphthoquinone |