Amlodipine besilate impurity G structure
|
Common Name | Amlodipine besilate impurity G | ||
|---|---|---|---|---|
| CAS Number | 43067-01-2 | Molecular Weight | 335.782 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 436.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.9±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Amlodipine besilate impurity GCalcium Channel antagonist 1 is an antagonist of Calcium Channel Calcium Channel antagonist 1 has the potential for the research of neurology disease[1]. |
| Name | Dimethyl 4-(2-Chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Calcium Channel antagonist 1 is an antagonist of Calcium Channel Calcium Channel antagonist 1 has the potential for the research of neurology disease[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.7±45.0 °C at 760 mmHg |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.782 |
| Flash Point | 217.9±28.7 °C |
| Exact Mass | 335.092438 |
| PSA | 64.63000 |
| LogP | 3.83 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | REIGLQUFMMOAFU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1ccccc1Cl |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P301 + P312 + P330-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Dimethyl 4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate |
| 3,5-Pyridinedicarboxylic acid, 4-(2-chlorophenyl)-1,4-dihydro-2,6-dimethyl-, dimethyl ester |
| dimethyl 4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Amlodipine Impurity 7 |