4-Methylphthalic acid structure
|
Common Name | 4-Methylphthalic acid | ||
|---|---|---|---|---|
| CAS Number | 4316-23-8 | Molecular Weight | 180.157 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 390.9±30.0 °C at 760 mmHg | |
| Molecular Formula | C9H8O4 | Melting Point | 146-148 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 204.4±21.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Methylphthalic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.9±30.0 °C at 760 mmHg |
| Melting Point | 146-148 °C(lit.) |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.157 |
| Flash Point | 204.4±21.1 °C |
| Exact Mass | 180.042252 |
| PSA | 74.60000 |
| LogP | 1.27 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | CWJJAFQCTXFSTA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)O)c(C(=O)O)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917399090 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
A catabolic plasmid involved in 4-methyl-o-phthalate and 4-hydroxy-iso-phthalate degradation in Pseudomonas cepacia.
FEMS Microbiol. Lett. 57(3) , 323-8, (1990) Genes involved in 4-methyl-o-phthalate and 4-hydroxy-iso-phthalate catabolism reside on a 226-232 kbp catabolic plasmid termed MOP. This was confirmed by transformation and conjugation into an isogeni... |
| 1,2-Benzenedicarboxylic acid, 4-methyl- |
| EINECS 224-333-8 |
| MFCD00041946 |
| 4-Methylphthalic acid |
| 4-methylbenzene-1,2-dicarboxylic acid |