4-Nitro-N,N-diphenylaniline structure
|
Common Name | 4-Nitro-N,N-diphenylaniline | ||
|---|---|---|---|---|
| CAS Number | 4316-57-8 | Molecular Weight | 290.316 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 452.6±28.0 °C at 760 mmHg | |
| Molecular Formula | C18H14N2O2 | Melting Point | 143-144ºC | |
| MSDS | N/A | Flash Point | 227.6±24.0 °C | |
| Name | 4-Nitrotriphenylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 452.6±28.0 °C at 760 mmHg |
| Melting Point | 143-144ºC |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.316 |
| Flash Point | 227.6±24.0 °C |
| Exact Mass | 290.105530 |
| PSA | 49.06000 |
| LogP | 6.02 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | UQOKZDUUBVGFAK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| Storage condition | -20?C Freezer |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2921420090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Nitro-N,N-diphenylaniline |
| (4-Nitro-phenyl)-diphenyl-amine |
| 4-NitrotriphenylaMine |
| 4-Nitrophenyl diphenylamine |
| Benzenamine, 4-nitro-N,N-diphenyl- |