4-nitro-N,N-bis(phenylsulfanyl)aniline structure
|
Common Name | 4-nitro-N,N-bis(phenylsulfanyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 88047-01-2 | Molecular Weight | 354.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitro-N,N-bis(phenylsulfanyl)aniline |
|---|
| Molecular Formula | C18H14N2O2S2 |
|---|---|
| Molecular Weight | 354.44600 |
| Exact Mass | 354.05000 |
| PSA | 99.66000 |
| LogP | 6.33900 |
| InChIKey | MYDUHULRVGTRFF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N(Sc2ccccc2)Sc2ccccc2)cc1 |
|
~39%
4-nitro-N,N-bis... CAS#:88047-01-2
Detail
|
| Literature: Balboni, Claudio; Benati, Luisa; Montevecchi, P. Carlo; Spagnolo, Piero Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2111 - 2117 |
|
~%
4-nitro-N,N-bis... CAS#:88047-01-2 |
| Literature: Balboni, Claudio; Benati, Luisa; Montevecchi, P. Carlo; Spagnolo, Piero Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2111 - 2117 |
|
~%
4-nitro-N,N-bis... CAS#:88047-01-2 |
| Literature: Balboni, Claudio; Benati, Luisa; Montevecchi, P. Carlo; Spagnolo, Piero Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2111 - 2117 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |