1,2,2,6,6-pentamethyl-4-piperidyl acrylate structure
|
Common Name | 1,2,2,6,6-pentamethyl-4-piperidyl acrylate | ||
|---|---|---|---|---|
| CAS Number | 43224-02-8 | Molecular Weight | 225.32700 | |
| Density | 0.97g/cm3 | Boiling Point | 255.5ºC at 760mmHg | |
| Molecular Formula | C13H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 75.9ºC | |
| Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 255.5ºC at 760mmHg |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.32700 |
| Flash Point | 75.9ºC |
| Exact Mass | 225.17300 |
| PSA | 29.54000 |
| LogP | 2.30490 |
| Index of Refraction | 1.48 |
| InChIKey | WPARMABOLAOINO-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2,2,6,6-pentamethyl-4-piperidinyl acrylate |
| 1,2,2,6,6-pentamethylpiperidin-4-yl acrylate |
| 1,2,2,6,6-Pentamethyl-4-piperidyl acrylate |
| EINECS 256-153-0 |