pth-l-phenylalanine structure
|
Common Name | pth-l-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 4332-97-2 | Molecular Weight | 282.36000 | |
| Density | 1.31g/cm3 | Boiling Point | 410.6ºC at 760 mmHg | |
| Molecular Formula | C16H14N2OS | Melting Point | 187ºC | |
| MSDS | N/A | Flash Point | 202.1ºC | |
| Name | Phenylthiohydantoin-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 410.6ºC at 760 mmHg |
| Melting Point | 187ºC |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.36000 |
| Flash Point | 202.1ºC |
| Exact Mass | 282.08300 |
| PSA | 64.43000 |
| LogP | 2.91280 |
| Index of Refraction | 1.699 |
| InChIKey | HIDCDSHFIITFOM-UHFFFAOYSA-N |
| SMILES | O=C1C(Cc2ccccc2)NC(=S)N1c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 224-372-0 |
| PTH-L-PHENYLALANINE |
| PTH-phenylalanine |
| 5-Benzyl-3-phenyl-2-thiohydantoin |