2,5-Cyclohexadien-1-one, 4-((3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl)methylene)-2,6-bis(1,1-dimethylethyl) structure
|
Common Name | 2,5-Cyclohexadien-1-one, 4-((3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl)methylene)-2,6-bis(1,1-dimethylethyl) | ||
|---|---|---|---|---|
| CAS Number | 4359-97-1 | Molecular Weight | 422.64300 | |
| Density | 1.012g/cm3 | Boiling Point | 512.6ºC at 760mmHg | |
| Molecular Formula | C29H42O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.9ºC | |
| Name | 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.012g/cm3 |
|---|---|
| Boiling Point | 512.6ºC at 760mmHg |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.64300 |
| Flash Point | 216.9ºC |
| Exact Mass | 422.31800 |
| PSA | 37.30000 |
| LogP | 7.89830 |
| InChIKey | HRLDHROCDBYHAU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C=C(C(C)(C)C)C1=O |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
|
Name: qHTS assay for inhibitors of human lactate dehydrogenase
Source: NCGC
Target: N/A
External Id: LDHA
|
|
Name: Primary qHTS Assay for Foot and Mouth Disease Virus Antivirals against NCGC Sytravon ...
Source: NCGC
External Id: stopgo-p2-SytraCBC-dual-FF
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Primary qHTS Assay for Foot and Mouth Disease Virus Antivirals against NCGC Sytravon ...
Source: NCGC
External Id: stopgo-p2-SytraCBC-dual-Ren
|
| hydrogalvinoxyl |