4,4'-Methylenebis(2,6-di-tert-butylphenol) structure
|
Common Name | 4,4'-Methylenebis(2,6-di-tert-butylphenol) | ||
|---|---|---|---|---|
| CAS Number | 118-82-1 | Molecular Weight | 424.659 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 459.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C29H44O2 | Melting Point | 155-159 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 178.1±21.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,4'-Methylenebis(2,6-di-tert-butylphenol) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 459.5±40.0 °C at 760 mmHg |
| Melting Point | 155-159 °C(lit.) |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.659 |
| Flash Point | 178.1±21.9 °C |
| Exact Mass | 424.334137 |
| PSA | 40.46000 |
| LogP | 9.49 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | MDWVSAYEQPLWMX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| RTECS | SL9650000 |
| HS Code | 2907299090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
|
Effects of four bisphenolic antioxidants on lipid contents of rat liver.
Toxicol. Lett. 8(1-2) , 77-86, (1981) Hepatic lipids were studied in Sprague-Dawley male rats given, 2,2'-methylenebis(4-ethyl-6-tert-butylphenol), 2,2'-methylenebis(4-methyl-6-tert-butylphenol), 4,4'-butylidenebis(3-methyl-6-tert-butylph... |
| Bis(3,5-di-tert-butyl-4-hydroxyphenyl)methane |
| 4,4'-Methylenebis[2,6-bis(2-methyl-2-propanyl)phenol] |
| 4,4'-methanediylbis(2,6-di-tert-butylphenol) |
| MFCD00008822 |
| Phenol, 4,4'-methylenebis[2,6-bis(1,1-dimethylethyl)- |
| Ethanox 702 |
| 3,3',5,5'-Tetra-tert-butyl-4,4'-dihydroxydiphenylmethane |
| Phenol, 4,4'-methylenebis[2,6-di-tert-butyl- |
| 4,4'-Methylenebis(2,6-di-tert-butylphenol) |
| EINECS 204-279-1 |
| 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenol |